CymitQuimica logo

CAS 114476-84-5

:

3-Chlorophenoxyacetyl chloride

Description:
3-Chlorophenoxyacetyl chloride is an organic compound characterized by its functional groups, specifically the presence of an acyl chloride and a chlorophenoxy moiety. It typically appears as a colorless to pale yellow liquid with a pungent odor, indicative of its reactivity. The compound is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. It is highly reactive, particularly with water, leading to the formation of hydrochloric acid and corresponding acids upon hydrolysis. This reactivity necessitates careful handling and storage under an inert atmosphere to prevent moisture exposure. Additionally, 3-Chlorophenoxyacetyl chloride is soluble in organic solvents such as dichloromethane and ether, but insoluble in water. Safety precautions are essential when working with this compound, as it can cause severe irritation to the skin, eyes, and respiratory system. Overall, its unique chemical structure and reactivity make it a valuable compound in synthetic organic chemistry.
Formula:C8H6Cl2O2
InChI:InChI=1/C8H6Cl2O2/c9-6-2-1-3-7(4-6)12-5-8(10)11/h1-4H,5H2
InChI key:KPINZNVDHXIYAR-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)OCC(=O)Cl)Cl
Found 2 products.