CymitQuimica logo

CAS 114482-57-4

:

Butenyloxybenzoicacidcyanophenylester; 96%

Description:
Butenyloxybenzoic acid cyanophenyl ester, with the CAS number 114482-57-4, is a chemical compound characterized by its complex structure, which includes a butenyl group, an oxybenzoic acid moiety, and a cyanophenyl ester functionality. This compound typically exhibits properties associated with esters, such as being relatively non-polar and having moderate solubility in organic solvents. It may also demonstrate specific reactivity due to the presence of the cyanophenyl group, which can participate in various chemical reactions, including nucleophilic substitutions. The compound is often utilized in research and industrial applications, particularly in organic synthesis and materials science. Its purity, indicated as 96%, suggests a high degree of refinement, making it suitable for precise applications in laboratory settings. Safety data should be consulted, as compounds of this nature may pose hazards such as toxicity or environmental risks. Proper handling and storage conditions are essential to ensure safety and stability.
Formula:C18H15NO3
InChI:InChI=1/C18H15NO3/c1-2-3-12-21-16-10-6-15(7-11-16)18(20)22-17-8-4-14(13-19)5-9-17/h2,4-11H,1,3,12H2
InChI key:XGRKLNHEYFRXFW-UHFFFAOYSA-N
SMILES:C=CCCOc1ccc(cc1)C(=O)Oc1ccc(cc1)C#N
Synonyms:
  • 4-(3-Butenyloxy)benzoic acid 4-cyanophenyl ester
  • 4-Cyanophenyl 4-(But-3-En-1-Yloxy)Benzoate
Found 4 products.