CymitQuimica logo

CAS 114498-55-4

:

Oxazolo[4,5-c]pyridin-2-amine (9CI)

Description:
Oxazolo[4,5-c]pyridin-2-amine, with the CAS number 114498-55-4, is a heterocyclic organic compound characterized by the presence of both an oxazole and a pyridine ring fused together. This compound typically exhibits a pale to light yellow crystalline appearance. It contains an amino group (-NH2) at the 2-position of the pyridine ring, which can influence its reactivity and solubility properties. The presence of the oxazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. Oxazolo[4,5-c]pyridin-2-amine may exhibit various pharmacological properties, including antimicrobial and anticancer activities, although specific biological data may vary. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in the field of pharmaceuticals. As with many heterocycles, the compound's stability, reactivity, and solubility can be influenced by the functional groups present and the overall electronic environment of the molecule.
Formula:C6H5N3O
InChI:InChI=1S/C6H5N3O/c7-6-9-4-3-8-2-1-5(4)10-6/h1-3H,(H2,7,9)
InChI key:FJHYVYMTPVSYDO-UHFFFAOYSA-N
SMILES:C1=CN=CC2=C1OC(=N2)N
Found 4 products.