CymitQuimica logo

CAS 1145-32-0

:

Benzoylglycylglycine; 99%

Description:
Benzoylglycylglycine, with the CAS number 1145-32-0, is a dipeptide derivative characterized by the presence of a benzoyl group attached to the amino acid glycine. This compound typically appears as a white to off-white crystalline powder and is soluble in polar solvents such as water and methanol, reflecting its polar nature due to the amino and carboxyl functional groups. It is often utilized in biochemical research and pharmaceutical applications, particularly in studies related to peptide synthesis and drug formulation. The presence of the benzoyl group can enhance the compound's stability and bioavailability. As a chemical substance, it may exhibit properties such as moderate melting points and specific reactivity patterns typical of peptides, including potential interactions with enzymes and receptors. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure proper safety measures are taken during use.
Formula:C11H12N2O4
InChI:InChI=1/C11H12N2O4/c14-9(12-7-10(15)16)6-13-11(17)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,14)(H,13,17)(H,15,16)
InChI key:FWYPSSZPXQVFRB-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(=NCC(=NCC(=O)O)O)O
Synonyms:
  • Benzoyl-glycyl-glycine
  • N-benzoylglycylglycine
Found 5 products.