CAS 1145-98-8
:DIPHENYLTETRAMETHYLDISILANE
Description:
Diphenyltetramethyldisilane, with the CAS number 1145-98-8, is an organosilicon compound characterized by its unique structure, which consists of two phenyl groups and a disilane backbone featuring four methyl groups. This compound is typically a colorless to pale yellow liquid and is known for its low volatility and high thermal stability. It exhibits hydrophobic properties, making it useful in various applications, including as a precursor in the synthesis of silicone materials and as a surface modifier. Diphenyltetramethyldisilane is also recognized for its ability to enhance the mechanical properties of polymers and improve adhesion in coatings. Additionally, it can participate in chemical reactions typical of silanes, such as hydrolysis and condensation, leading to the formation of siloxane networks. Safety data indicates that, while it may pose some health risks upon exposure, proper handling and safety measures can mitigate these concerns. Overall, its versatility and stability make it a valuable compound in materials science and chemical manufacturing.
Formula:C16H22Si2
InChI:InChI=1/C16H22Si2/c1-17(2,15-11-7-5-8-12-15)18(3,4)16-13-9-6-10-14-16/h5-14H,1-4H3
SMILES:C[Si](C)(c1ccccc1)[Si](C)(C)c1ccccc1
Synonyms:- 1,1,2,2-Tetramethyl-1,2-diphenyldisilane
- Disilane,1,1,2,2-tetramethyl-1,2-diphenyl-
- 1,2-Diphenyltetramethyldisilane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,1,2,2-Tetramethyl-1,2-diphenyldisilane, 95%
CAS:Dimethylphenylsilane was catalytically dehydrogenated and condensed in the presence of platinum complexes to give 1,1,2,2-tetramethyl-1,2-diphenyl-disilane. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label informatioFormula:C16H22Si2Purity:95%Color and Shape:White to pale yellow, Powder and/or lumps or fused solidMolecular weight:270.521,1,2,2-Tetramethyl-1,2-diphenyldisilane
CAS:1,1,2,2-Tetramethyl-1,2-diphenyldisilaneFormula:C16H22Si2Purity:98%Color and Shape:Beige SolidMolecular weight:270.51688Disilane, 1,1,2,2-tetramethyl-1,2-diphenyl-
CAS:Formula:C16H22Si2Purity:97%Color and Shape:SolidMolecular weight:270.51691,1,2,2-Tetramethyl-1,2-diphenyldisilane
CAS:Formula:C16H22Si2Purity:>95.0%(GC)Color and Shape:White to Light yellow powder to lumpMolecular weight:270.521,2-Diphenyltetramethyldisilane
CAS:S08125 - 1,2-Diphenyltetramethyldisilane
Formula:C16H22Si2Purity:97%Color and Shape:SolidMolecular weight:270.522




