CymitQuimica logo

CAS 114561-15-8

:

3-(hydroxymethyl)-1-methylquinolin-2(1H)-one

Description:
3-(Hydroxymethyl)-1-methylquinolin-2(1H)-one, with the CAS number 114561-15-8, is a chemical compound belonging to the quinoline family, characterized by a fused bicyclic structure that includes a nitrogen atom. This compound features a hydroxymethyl group (-CH2OH) and a methyl group (-CH3) attached to the quinoline ring, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxymethyl group. The compound may display biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure allows for potential interactions with biological targets, and it may participate in various chemical reactions, including oxidation and substitution. As with many quinoline derivatives, it may also exhibit fluorescence, which can be useful in analytical applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C11H11NO2
InChI:InChI=1/C11H11NO2/c1-12-10-5-3-2-4-8(10)6-9(7-13)11(12)14/h2-6,13H,7H2,1H3
InChI key:RZVICXIGFUNOSW-UHFFFAOYSA-N
SMILES:Cn1c2ccccc2cc(CO)c1=O
Synonyms:
  • 2(1H)-quinolinone, 3-(hydroxymethyl)-1-methyl-
Found 3 products.