CAS 114583-08-3
:2-TERTBUTYL-9,10-DIBROMOANTHRACENE
Description:
2-Tertbutyl-9,10-dibromoanthracene is an organic compound characterized by its structure, which includes a tert-butyl group and two bromine atoms attached to the anthracene framework. This compound belongs to the class of polycyclic aromatic hydrocarbons (PAHs) and is notable for its potential applications in organic electronics and materials science due to its unique electronic properties. The presence of bromine substituents can enhance its reactivity and solubility in various solvents, making it useful in synthetic chemistry. Additionally, the tert-butyl group contributes to steric hindrance, which can influence the compound's stability and reactivity. The compound's physical properties, such as melting point, boiling point, and solubility, are influenced by its molecular structure and substituents. As with many brominated compounds, it is essential to handle 2-tertbutyl-9,10-dibromoanthracene with care due to potential environmental and health impacts associated with brominated organic compounds. Overall, this compound represents a significant area of interest in both academic research and industrial applications.
Formula:C18H16Br2
InChI:InChI=1/C18H16Br2/c1-18(2,3)11-8-9-14-15(10-11)17(20)13-7-5-4-6-12(13)16(14)19/h4-10H,1-3H3
InChI key:BWFOVZDGMFZPFX-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC2=C(C3=CC=CC=C3C(=C2C=C1)Br)Br
Synonyms:- 9,10-dibromo-2-tert-butyl-anthracene
- 9,10-dibromo-2-tert-butylanthracene
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
