CAS 114584-09-7
:1H-Inden-6-ol, 3-(4-hydroxyphenyl)-2-(3-pyridinyl)-
Description:
1H-Inden-6-ol, 3-(4-hydroxyphenyl)-2-(3-pyridinyl)-, identified by CAS number 114584-09-7, is an organic compound characterized by its complex structure, which includes an indene core substituted with a hydroxyl group and phenyl and pyridine rings. This compound features a hydroxyl (-OH) group, contributing to its potential as a phenolic compound, which may impart antioxidant properties. The presence of the pyridine ring suggests possible interactions with biological systems, making it of interest in medicinal chemistry. Its molecular structure indicates potential for hydrogen bonding due to the hydroxyl group, which can influence its solubility and reactivity. Additionally, the compound may exhibit various functional properties, including potential applications in pharmaceuticals or as a building block in organic synthesis. The specific arrangement of substituents on the indene framework can affect its electronic properties and reactivity, making it a subject of interest for further research in both synthetic and applied chemistry contexts.
Formula:C20H15NO2
InChI:InChI=1S/C20H15NO2/c22-16-5-3-13(4-6-16)20-18-8-7-17(23)10-15(18)11-19(20)14-2-1-9-21-12-14/h1-10,12,22-23H,11H2
InChI key:XTTOBACUCDXYST-UHFFFAOYSA-N
SMILES:C1C2=C(C=CC(=C2)O)C(=C1C3=CN=CC=C3)C4=CC=C(C=C4)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
