CymitQuimica logo

CAS 1146080-31-0

:

2-Chloro-1-(5-nitro-2-pyridinyl)-1H-benzimidazole

Description:
2-Chloro-1-(5-nitro-2-pyridinyl)-1H-benzimidazole is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a chloro group and a nitro-pyridine moiety. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The presence of the chloro and nitro groups contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and pharmaceutical research. The nitro group can participate in reduction reactions, while the chloro group may serve as a site for further substitution reactions. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Its unique structure suggests potential applications in drug development, particularly in targeting specific biological pathways or mechanisms. As with many chemical substances, safety and handling precautions should be observed due to its potential toxicity and environmental impact.
Formula:C12H7ClN4O2
InChI:InChI=1S/C12H7ClN4O2/c13-12-15-9-3-1-2-4-10(9)16(12)11-6-5-8(7-14-11)17(18)19/h1-7H
InChI key:InChIKey=VWDXCWGXQHCOJQ-UHFFFAOYSA-N
SMILES:ClC=1N(C=2C(N1)=CC=CC2)C3=CC=C(N(=O)=O)C=N3
Synonyms:
  • 1H-Benzimidazole, 2-chloro-1-(5-nitro-2-pyridinyl)-
  • 2-Chloro-1-(5-nitro-2-pyridinyl)-1H-benzimidazole
Found 2 products.