CymitQuimica logo

CAS 1146355-33-0

:

3-methoxy-5-(trifluoromethyl)benzenesulphonyl chloride

Description:
3-Methoxy-5-(trifluoromethyl)benzenesulphonyl chloride is an organic compound characterized by the presence of a sulphonyl chloride functional group attached to a benzene ring that also features a methoxy group and a trifluoromethyl substituent. The methoxy group (-OCH3) enhances the compound's solubility in organic solvents and can influence its reactivity, while the trifluoromethyl group (-CF3) is known for imparting unique electronic properties, often enhancing lipophilicity and stability. This compound is typically used in organic synthesis, particularly in the preparation of sulphonamides and other derivatives due to its electrophilic nature. The sulphonyl chloride moiety is highly reactive, making it a valuable intermediate in various chemical reactions, including nucleophilic substitutions. Additionally, the presence of fluorine atoms can affect the compound's physical properties, such as boiling point and polarity. Safety precautions should be taken when handling this compound, as sulphonyl chlorides can be corrosive and may release toxic gases upon reaction with water or other nucleophiles.
Formula:C8H6ClF3O3S
InChI:InChI=1S/C8H6ClF3O3S/c1-15-6-2-5(8(10,11)12)3-7(4-6)16(9,13)14/h2-4H,1H3
InChI key:JCJFHWJIWNJCOC-UHFFFAOYSA-N
SMILES:COC1=CC(=CC(=C1)C(F)(F)F)S(=O)(=O)Cl
Found 2 products.