CymitQuimica logo

CAS 114661-95-9

:

Ethanone, 1-[1-methoxy-4-(2-propenyloxy)-2-naphthalenyl]-

Description:
Ethanone, 1-[1-methoxy-4-(2-propenyloxy)-2-naphthalenyl]- is an organic compound characterized by its complex structure, which includes a naphthalene ring substituted with methoxy and propenyloxy groups. This compound features a ketone functional group, which is indicative of ethanone derivatives. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. The propenyloxy substituent suggests potential for further chemical transformations, such as polymerization or cross-linking reactions. This compound may exhibit interesting optical properties due to the conjugated system provided by the naphthalene moiety, making it potentially useful in applications such as organic electronics or as a dye. Additionally, the structural features may impart specific biological activities, warranting investigation in pharmacological contexts. Overall, the unique combination of functional groups and structural elements contributes to the compound's potential utility in various chemical and industrial applications.
Formula:C16H16O3
InChI:InChI=1S/C16H16O3/c1-4-9-19-15-10-14(11(2)17)16(18-3)13-8-6-5-7-12(13)15/h4-8,10H,1,9H2,2-3H3
InChI key:KZBUYQGRZMBMDU-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C2=CC=CC=C2C(=C1)OCC=C)OC
Found 1 products.