CymitQuimica logo

CAS 114676-93-6

:

(2R,4R)-N-Boc-4-hydroxy-2-methylpyrrolidine

Description:
(2R,4R)-N-Boc-4-hydroxy-2-methylpyrrolidine is a chemical compound characterized by its pyrrolidine ring structure, which features a hydroxyl group at the 4-position and a tert-butoxycarbonyl (Boc) protecting group at the nitrogen. This compound is a chiral molecule, with specific stereochemistry at the 2 and 4 positions, contributing to its potential biological activity and utility in asymmetric synthesis. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The Boc group serves as a protective group, allowing for selective reactions at other functional sites while preventing unwanted reactions at the amine. This compound is often utilized in the synthesis of pharmaceuticals and biologically active molecules, making it significant in medicinal chemistry. Its stability under standard laboratory conditions and its ability to undergo further transformations make it a valuable intermediate in organic synthesis.
Formula:C10H19NO3
InChI:InChI=1/C10H19NO3/c1-7-5-8(12)6-11(7)9(13)14-10(2,3)4/h7-8,12H,5-6H2,1-4H3/t7-,8-/m1/s1
InChI key:BXZADLGAYWRZCR-UHFFFAOYSA-N
SMILES:C[C@@H]1C[C@H](CN1C(=O)OC(C)(C)C)O
Synonyms:
  • (2R,4R)-1-(tert-Butoxycarbonyl)-4-hydroxy-2-methylpyrrolidine
  • (2R,4R)-4-Hydroxy-2-methyl-1-pyrrolidinecarboxylic acid 1,1-dimethylethyl ester
  • (2R,4R)-tert-Butyl 4-hydroxy-2-methylpyrrolidine-1-carboxylate
Found 4 products.