CAS 114686-81-6
:(2,3-DICHLOROPHENYL)ACETALDEHYDE
Description:
(2,3-Dichlorophenyl)acetaldehyde is an organic compound characterized by the presence of a dichlorophenyl group attached to an acetaldehyde functional group. It typically appears as a colorless to pale yellow liquid with a distinctive odor. The compound is known for its reactivity due to the presence of the aldehyde functional group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The dichlorophenyl moiety contributes to its potential biological activity and may influence its solubility and stability in different solvents. This compound is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Proper storage conditions are essential to maintain its integrity and prevent degradation. Overall, (2,3-dichlorophenyl)acetaldehyde is a valuable compound in chemical research and industrial applications.
Formula:C8H6Cl2O
InChI:InChI=1S/C8H6Cl2O/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3,5H,4H2
InChI key:BTRPFUUMJDFUAF-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)Cl)Cl)CC=O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
