CymitQuimica logo

CAS 1146970-26-4

:

5-Chloro-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine

Description:
5-Chloro-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 5-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish appearance and is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various functionalization possibilities, which can lead to derivatives with enhanced pharmacological properties. The compound's stability is influenced by the presence of the chlorine substituent, which can affect its electronic properties and reactivity. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C7H7ClN2
InChI:InChI=1S/C7H7ClN2/c8-6-3-5-1-2-9-7(5)10-4-6/h3-4H,1-2H2,(H,9,10)
InChI key:BJOJWDWNAMHDKG-UHFFFAOYSA-N
SMILES:C1CNC2=C1C=C(C=N2)Cl
Synonyms:
  • 5-chloro-1H,2H,3H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-2,3-dihydro-
  • 5-Chloro-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine
Found 4 products.