CymitQuimica logo

CAS 114722-60-0

:

Pyrazolo[1,5-a]quinoxalin-4(5H)-one (6CI)

Description:
Pyrazolo[1,5-a]quinoxalin-4(5H)-one, with the CAS number 114722-60-0, is a heterocyclic compound characterized by its fused pyrazole and quinoxaline rings. This compound typically exhibits a planar structure, which contributes to its potential interactions in biological systems. It is known for its diverse pharmacological properties, including potential anti-inflammatory, antitumor, and antimicrobial activities. The presence of the pyrazole moiety often enhances its ability to interact with various biological targets, making it a subject of interest in medicinal chemistry. Additionally, the compound may exhibit moderate solubility in organic solvents, which can influence its bioavailability and efficacy in therapeutic applications. Its synthesis often involves multi-step organic reactions, highlighting its complexity and the need for careful handling in laboratory settings. Overall, Pyrazolo[1,5-a]quinoxalin-4(5H)-one represents a significant class of compounds in drug discovery, with ongoing research aimed at elucidating its mechanisms of action and optimizing its pharmacological profiles.
Formula:C10 H7 N3 O
InChI:InChI=1S/C10H7N3O/c14-10-9-5-6-11-13(9)8-4-2-1-3-7(8)12-10/h1-6H,(H,12,14)
InChI key:BNKZAGNSCZCLIN-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)NC(=O)C3=CC=NN23
Synonyms:
  • Pyrazolo[1,5-A]Quinoxalin-4(5H)-One
Found 2 products.