CymitQuimica logo

CAS 114745-45-8

:

ethyl (1R,2S)-2-aminocyclopentanecarboxylate

Description:
Ethyl (1R,2S)-2-aminocyclopentanecarboxylate, with the CAS number 114745-45-8, is a chemical compound characterized by its cyclic structure and the presence of both an amino group and an ester functional group. This compound features a cyclopentane ring, which contributes to its unique three-dimensional conformation, influencing its reactivity and interactions. The specific stereochemistry indicated by the (1R,2S) configuration suggests that the compound has distinct spatial arrangements of its substituents, which can significantly affect its biological activity and properties. Ethyl (1R,2S)-2-aminocyclopentanecarboxylate is often studied in the context of medicinal chemistry due to its potential applications in drug development, particularly in the synthesis of compounds that may exhibit neuroactive or pharmacological effects. Its solubility and stability in various solvents can vary, making it important to consider these factors in practical applications. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with chiral centers.
Formula:C8H15NO2
InChI:InChI=1/C8H15NO2/c1-2-11-8(10)6-4-3-5-7(6)9/h6-7H,2-5,9H2,1H3/t6-,7+/m1/s1
InChI key:AGCJYTRMZBPEEO-RQJHMYQMSA-N
SMILES:CCOC(=O)[C@@H]1CCC[C@@H]1N
Synonyms:
  • cyclopentanecarboxylic acid, 2-amino-, ethyl ester, (1R,2S)-
Found 2 products.