CymitQuimica logo

CAS 114781-14-5

:

(R)-2-AMINO-2-ETHYLHEXANOIC ACID

Description:
(R)-2-Amino-2-ethylhexanoic acid, also known as L-2-amino-2-ethylhexanoic acid, is a chiral amino acid characterized by its branched-chain structure. It features an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical functional groups found in amino acids. This compound is notable for its potential applications in biochemistry and pharmaceuticals, particularly in the synthesis of peptides and as a building block for various biochemical processes. The presence of the ethyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. As a chiral molecule, it exists in two enantiomeric forms, with the (R) configuration being biologically relevant. Its CAS number, 114781-14-5, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases. Overall, (R)-2-amino-2-ethylhexanoic acid is significant in research related to amino acid metabolism and the development of novel therapeutic agents.
Formula:C8H17NO2
InChI:InChI=1S/C8H17NO2/c1-3-5-6-8(9,4-2)7(10)11/h3-6,9H2,1-2H3,(H,10,11)/t8-/m1/s1
InChI key:QUDXVGQYPUXXER-MRVPVSSYSA-N
SMILES:CCCC[C@](CC)(C(=O)O)N
Found 2 products.