CymitQuimica logo

CAS 114790-39-5

:

benzyl (2,2-dimethoxyethyl)carbamate

Description:
Benzyl (2,2-dimethoxyethyl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of an amine with a carbonyl compound. This substance features a benzyl group, providing aromatic characteristics, and a 2,2-dimethoxyethyl moiety, which contributes to its solubility and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the methoxy groups enhances its polar character, making it soluble in various organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its stability and reactivity can be influenced by environmental factors such as temperature and pH. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, benzyl (2,2-dimethoxyethyl)carbamate is a versatile compound with potential applications in synthesis and research.
Formula:C12H17NO4
InChI:InChI=1/C12H17NO4/c1-15-11(16-2)8-13-12(14)17-9-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3,(H,13,14)
InChI key:SGVVZHZJVANCRU-UHFFFAOYSA-N
SMILES:COC(CN=C(O)OCc1ccccc1)OC
Synonyms:
  • Benzyl-(2,2-dimethoxyethyl)carbamat
Found 4 products.