CymitQuimica logo

CAS 114799-13-2

:

1H-Imidazole-4-methanol,2-butyl-5-chloro-1-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]-

Description:
1H-Imidazole-4-methanol, 2-butyl-5-chloro-1-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]- is a complex organic compound characterized by its imidazole and tetrazole functional groups, which contribute to its potential biological activity. The presence of a butyl group and a chloro substituent suggests that the compound may exhibit hydrophobic properties, influencing its solubility and interaction with biological membranes. The biphenyl moiety can enhance the compound's stability and may play a role in its binding affinity to target proteins or receptors. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of multiple functional groups that can participate in various chemical reactions. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular structure and the arrangement of its substituents. Further studies would be necessary to elucidate its biological activity and potential applications in drug development.
Formula:C22H23ClN6O
InChI:InChI=1S/C22H23ClN6O/c1-2-3-8-20-24-19(14-30)21(23)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22/h4-7,9-12,30H,2-3,8,13-14H2,1H3,(H,25,26,27,28)
InChI key:JWFIXKFLBIURBL-UHFFFAOYSA-N
SMILES:CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NNN=N4)Cl)CO
Found 6 products.