CymitQuimica logo

CAS 1148044-31-8

:

1-N-Boc-1,6-diaza-spiro[3.4]octane

Description:
1-N-Boc-1,6-diaza-spiro[3.4]octane is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework with two nitrogen atoms incorporated into the ring system. The "Boc" (tert-butoxycarbonyl) group is a common protecting group in organic synthesis, particularly for amines, indicating that this compound likely has amine functionalities that are protected to prevent unwanted reactions during synthesis. The presence of the diaza moiety suggests that the compound may exhibit interesting coordination chemistry and potential biological activity, as nitrogen-containing compounds often play significant roles in pharmacology. Additionally, the spiro structure can impart unique steric and electronic properties, which may influence the compound's reactivity and interactions with other molecules. Overall, 1-N-Boc-1,6-diaza-spiro[3.4]octane is of interest in synthetic organic chemistry and may have applications in drug development or materials science due to its distinctive structural features.
Formula:C11H20N2O2
InChI:InChI=1S/C11H20N2O2/c1-10(2,3)15-9(14)13-7-5-11(13)4-6-12-8-11/h12H,4-8H2,1-3H3
InChI key:OJDKDBHLSUSOBW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC12CCNC2
Found 5 products.