CymitQuimica logo

CAS 114853-29-1

:

2-Propenyl 2-Deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)--D-glucopyranoside

Description:
2-Propenyl 2-Deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)--D-glucopyranoside, with CAS number 114853-29-1, is a complex organic compound characterized by its glycosidic structure, which includes a glucopyranoside moiety. This compound features a propenyl group, indicating the presence of an unsaturated carbon chain, which can influence its reactivity and potential applications in organic synthesis or medicinal chemistry. The isoindole derivative contributes to its unique chemical properties, including potential biological activity. The presence of the dioxo group suggests that it may participate in various chemical reactions, such as oxidation or nucleophilic attacks. Additionally, the stereochemistry of the glucopyranoside unit may affect its interactions with biological targets, making it of interest in pharmacological studies. Overall, this compound exemplifies the intricate relationship between structure and function in organic molecules, particularly those with potential therapeutic applications.
Formula:C17H19NO7
InChI:InChI=1/C17H19NO7/c1-2-7-24-17-12(14(21)13(20)11(8-19)25-17)18-15(22)9-5-3-4-6-10(9)16(18)23/h2-6,11-14,17,19-21H,1,7-8H2/t11?,12?,13-,14-,17-/m1/s1
InChI key:ZPZAUIIISMQKHG-CVXDVXMKSA-N
SMILES:C=CCO[C@H]1C([C@H]([C@@H](C(CO)O1)O)O)N1C(=O)c2ccccc2C1=O
Synonyms:
  • Allyl 2-Deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)--D-glucopyranoside
Found 3 products.