CymitQuimica logo

CAS 114857-00-0

:

Carbamic acid, (1-methyl-2-oxoethyl)-, 1,1-dimethylethyl ester (9CI)

Description:
Carbamic acid, (1-methyl-2-oxoethyl)-, 1,1-dimethylethyl ester, commonly referred to by its CAS number 114857-00-0, is an organic compound characterized by its ester functional group derived from carbamic acid. This substance features a structure that includes a carbamate moiety, which is typically associated with biological activity and potential applications in agriculture, particularly as a pesticide or herbicide. The presence of the 1-methyl-2-oxoethyl group suggests that it may exhibit specific reactivity patterns, potentially influencing its solubility and stability in various environments. As an ester, it is likely to be less polar than its corresponding acid, which can affect its interaction with biological systems. Additionally, the presence of the tert-butyl group (1,1-dimethylethyl) may enhance its lipophilicity, impacting its absorption and distribution in living organisms. Overall, this compound's characteristics make it of interest in both synthetic organic chemistry and applied fields such as agrochemicals.
Formula:C8H15NO3
InChI:InChI=1S/C8H15NO3/c1-6(5-10)9-7(11)12-8(2,3)4/h5-6H,1-4H3,(H,9,11)
InChI key:OEQRZPWMXXJEKU-UHFFFAOYSA-N
SMILES:CC(C=O)NC(=O)OC(C)(C)C
Found 4 products.