CAS 114869-95-3
:a-D-Glucopyranoside, methyl 2-deoxy-2-[[(phenylmethoxy)carbonyl]amino]-3-O-(phenylmethyl)-, 6-acetate
Description:
The chemical substance known as a-D-Glucopyranoside, methyl 2-deoxy-2-[[(phenylmethoxy)carbonyl]amino]-3-O-(phenylmethyl)-, 6-acetate, with the CAS number 114869-95-3, is a complex glycoside derivative. It features a glucopyranoside backbone, which is a six-membered cyclic form of glucose, modified with various functional groups that enhance its reactivity and solubility. The presence of a methyl group at the 2-deoxy position indicates a modification that can influence its biological activity. The phenylmethoxycarbonyl group suggests potential applications in organic synthesis or medicinal chemistry, as it may serve as a protective group or a linker in drug design. Additionally, the acetate group at the 6-position can affect the compound's stability and solubility in different solvents. Overall, this compound's structural complexity and functional groups suggest potential utility in biochemical research, particularly in studies related to carbohydrate chemistry and drug development. Its specific properties, such as solubility, melting point, and reactivity, would need to be determined through experimental characterization.
Formula:C24H29NO8
InChI:InChI=1S/C24H29NO8/c1-16(26)30-15-19-21(27)22(31-13-17-9-5-3-6-10-17)20(23(29-2)33-19)25-24(28)32-14-18-11-7-4-8-12-18/h3-12,19-23,27H,13-15H2,1-2H3,(H,25,28)/t19-,20-,21-,22-,23+/m1/s1
InChI key:VOTXJTGQZBSOKH-JLMDMGSGSA-N
SMILES:CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC)NC(=O)OCC2=CC=CC=C2)OCC3=CC=CC=C3)O
Synonyms:- Methyl 6-o-acetyl-3-o-benzyl-2-benzyloxycarbonylamino-2-deoxy-a-d-glucopyranose
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Methyl 6-O-acetyl-3-O-benzyl-2-benzyloxycarbonylamino-2-deoxy-α-D-glucopyranoside
CAS:Methyl 6-O-acetyl-3-O-benzyl-2-benzyloxycarbonylamino-2-deoxy-α-D-glucopyranosideFormula:C24H29NO8Purity:>99%Molecular weight:459.48896[(2R,3S,4R,5R,6S)-3-hydroxy-6-methoxy-4-phenylmethoxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate
CAS:Formula:C24H29NO8Purity:95%+Molecular weight:459.4890Methyl 6-O-acetyl-3-O-benzyl-2-benzyloxycarbonylamino-2-deoxy-a-D-glucopyranoside
CAS:Methyl 6-O-acetyl-3-O-benzyl-2-benzyloxycarbonylamino-2-deoxy-a-Dglucopyranoside is a synthetic sugar with an acetyl group at the 6th position and a benzyloxycarbonyl group at the 3rd position. This sugar has been modified to produce complex carbohydrates, oligosaccharides, and polysaccharides. Methyl 6-O-acetyl 3 -O -benzyl 2 -benzyloxycarbonylamino 2 -deoxy a D glucopyranoside is used in the synthesis of glycosylates, which are sugars that have been modified by the addition of other molecules. This molecule is also used in click chemistry as it can be modified by adding fluorine atoms to its structure. Methyl 6 -O -acetyl 3 -O -benzyl 2 -benzyloxycarbonylamFormula:C24H29NO8Purity:Min. 95%Molecular weight:459.49 g/mol




