CAS 1149383-30-1

Formula: C9H9NO3

InChI: InChI=1S/C9H9NO3/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3,(H2,10,11)(H,12,13)

InChI key: JDVUCGQRDDFTJL-UHFFFAOYSA-N

SMILES: CC1=C(C=CC=C1C(=O)O)C(=O)N

3-Carbamoyl-2-methylbenzoic acid

CAS: 1149383-30-1

3-Carbamoyl-2-methylbenzoic acid is an activated benzoate compound that is commonly used in organic synthesis and as a research chemical. It acts as an inhibitor for various enzymes and has been shown to have pharmacological properties. This compound has been found to neutralize the activity of pro-inflammatory cytokines, such as TNF-α, making it a potential therapeutic agent for inflammatory conditions. Additionally, 3-Carbamoyl-2-methylbenzoic acid has been studied for its effects on mesenchymal stem cells and its potential as a histone deacetylase inhibitor. Its versatility and ability to undergo biotransformations make it a valuable tool in the field of organic chemistry and drug discovery.

Formula: C₉H₉NO₃

Purity: Min. 95%

Molecular weight: 179.17 g/mol

Ref: 3D-ZVB38330