CymitQuimica logo

CAS 1149388-20-4

:

Methyl 4-bromo-3-methoxy-2-methylbenzoate

Description:
Methyl 4-bromo-3-methoxy-2-methylbenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with various functional groups. The presence of a bromine atom, a methoxy group, and a methyl group on the benzene ring contributes to its unique chemical properties. This compound is typically classified as an ester, derived from benzoic acid, and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests it may exhibit moderate polarity due to the methoxy group, influencing its solubility in organic solvents. Additionally, the bromine substituent can impart specific reactivity, making it useful in electrophilic substitution reactions. The compound's stability and reactivity can be affected by the steric and electronic effects of the substituents on the aromatic ring. Overall, Methyl 4-bromo-3-methoxy-2-methylbenzoate is a versatile compound with significant implications in chemical research and industrial applications.
Formula:C10H11BrO3
InChI:InChI=1S/C10H11BrO3/c1-6-7(10(12)14-3)4-5-8(11)9(6)13-2/h4-5H,1-3H3
InChI key:InChIKey=DPPPRTUMXZNOTJ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C)C(OC)=C(Br)C=C1
Synonyms:
  • Benzoic acid, 4-bromo-3-methoxy-2-methyl-, methyl ester
  • Methyl 4-bromo-3-methoxy-2-methylbenzoate
  • Methyl 4-bromo-2-methyl-3-(methyloxy)benzoate
Found 2 products.