CymitQuimica logo

CAS 1150-31-8

:

Benzenesulfonamide, 4-methyl-N-octyl-

Description:
Benzenesulfonamide, 4-methyl-N-octyl- is an organic compound characterized by its sulfonamide functional group, which consists of a benzene ring substituted with a methyl group at the para position and an octyl chain attached to the nitrogen atom. This compound is typically a white to off-white solid at room temperature and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the octyl group. The presence of the sulfonamide group imparts certain biological activities, making it of interest in pharmaceutical and agrochemical applications. Its structure allows for potential interactions with biological systems, which can influence its reactivity and stability. Additionally, the compound may exhibit properties such as antimicrobial activity, making it relevant in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices.
Formula:C15H25NO2S
InChI:InChI=1S/C15H25NO2S/c1-3-4-5-6-7-8-13-16-19(17,18)15-11-9-14(2)10-12-15/h9-12,16H,3-8,13H2,1-2H3
InChI key:ZOKHEWHJVBLKRN-UHFFFAOYSA-N
SMILES:CCCCCCCCNS(=O)(=O)C1=CC=C(C=C1)C
Found 3 products.