CymitQuimica logo

CAS 1150114-33-2

:

(5-((((Benzyloxy)carbonyl)amino)methyl)-thiophen-2-yl)boronic acid

Description:
(5-((((Benzyloxy)carbonyl)amino)methyl)-thiophen-2-yl)boronic acid) is a boronic acid derivative characterized by the presence of a thiophene ring, which contributes to its aromatic properties and potential reactivity. The compound features a benzyloxycarbonyl group, which enhances its stability and solubility in organic solvents. The boronic acid functional group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound may exhibit biological activity due to the presence of the thiophene moiety, which is often associated with pharmacological properties. Additionally, the presence of the amino and boronic acid groups suggests potential for interactions with biological targets, making it a candidate for further research in drug development. Its structural complexity and functional groups may also allow for diverse reactivity in synthetic pathways, particularly in the formation of carbon-carbon bonds through cross-coupling reactions. Overall, this compound represents a versatile building block in both organic synthesis and medicinal chemistry.
Formula:C13H14BNO4S
InChI:InChI=1S/C13H14BNO4S/c16-13(19-9-10-4-2-1-3-5-10)15-8-11-6-7-12(20-11)14(17)18/h1-7,17-18H,8-9H2,(H,15,16)
InChI key:SQIAUEBFZXVDHP-UHFFFAOYSA-N
SMILES:B(C1=CC=C(S1)CNC(=O)OCC2=CC=CC=C2)(O)O
Synonyms:
  • Carbamic acid, N-[(5-borono-2-thienyl)methyl]-, C-(phenylmethyl) ester
Found 2 products.