CymitQuimica logo

CAS 1150114-59-2

:

B-(4,5-Difluoro-2-nitrophenyl)boronic acid

Description:
B-(4,5-Difluoro-2-nitrophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both nitro and difluoro groups. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The presence of the boronic acid moiety allows it to participate in various chemical reactions, particularly in Suzuki coupling reactions, which are essential in organic synthesis for forming carbon-carbon bonds. The difluoro and nitro substituents can influence the electronic properties of the molecule, potentially enhancing its reactivity and selectivity in chemical transformations. Additionally, boronic acids are known for their ability to form reversible complexes with diols, which can be exploited in sensor applications and drug design. Overall, B-(4,5-Difluoro-2-nitrophenyl)boronic acid is a valuable compound in synthetic organic chemistry and materials science due to its unique structural features and reactivity.
Formula:C6H4BF2NO4
InChI:InChI=1S/C6H4BF2NO4/c8-4-1-3(7(11)12)6(10(13)14)2-5(4)9/h1-2,11-12H
InChI key:InChIKey=CAHNMXZHYNLNCI-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(N(=O)=O)C=C(F)C(F)=C1
Synonyms:
  • B-(4,5-Difluoro-2-nitrophenyl)boronic acid
  • Boronic acid, B-(4,5-difluoro-2-nitrophenyl)-
Found 2 products.