CymitQuimica logo

CAS 1150164-05-8

:

Methyl 3-cyclopropyl-1H-pyrazole-4-carboxylate

Description:
Methyl 3-cyclopropyl-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a cyclopropyl group, a three-membered carbon ring, attached to the pyrazole, contributing to its unique reactivity and potential biological activity. The presence of the carboxylate functional group, specifically the methyl ester, enhances its solubility and reactivity, making it a useful intermediate in organic synthesis. Methyl 3-cyclopropyl-1H-pyrazole-4-carboxylate may exhibit various pharmacological properties, which can be explored in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Additionally, the compound's stability, reactivity, and potential applications in agrochemicals or pharmaceuticals are influenced by the arrangement of its functional groups. Overall, this compound represents a versatile scaffold for further chemical modifications and investigations in various fields of research.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-12-8(11)6-4-9-10-7(6)5-2-3-5/h4-5H,2-3H2,1H3,(H,9,10)
InChI key:InChIKey=WNRWNMMDWGFLJY-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(=NNC1)C2CC2
Synonyms:
  • 5-Cyclopropyl-1H-pyrazole-4-carboxylic acid methyl ester
  • 1H-Pyrazole-4-carboxylic acid, 3-cyclopropyl-, methyl ester
  • 3-Cyclopropyl-1H-pyrazole-4-carboxylic acid methyl ester
  • Methyl 3-cyclopropyl-1H-pyrazole-4-carboxylate
Found 4 products.