CymitQuimica logo

CAS 1150164-78-5

:

2-Chloro-α,α-difluorobenzeneacetic acid

Description:
2-Chloro-α,α-difluorobenzeneacetic acid is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with a chlorine atom and two fluorine atoms, along with an acetic acid functional group. This compound is typically classified as an aromatic carboxylic acid due to the presence of the carboxylic acid (-COOH) group. The chlorine and fluorine substituents contribute to its reactivity and influence its physical properties, such as solubility and boiling point. The presence of electronegative halogens can enhance the compound's acidity compared to non-halogenated analogs. Additionally, the compound may exhibit interesting biological activity, making it of interest in pharmaceutical and agrochemical research. Its synthesis and handling require careful consideration of safety protocols due to the potential hazards associated with halogenated compounds. Overall, 2-Chloro-α,α-difluorobenzeneacetic acid represents a valuable compound in organic chemistry with applications in various fields.
Formula:C8H5ClF2O2
InChI:InChI=1S/C8H5ClF2O2/c9-6-4-2-1-3-5(6)8(10,11)7(12)13/h1-4H,(H,12,13)
InChI key:InChIKey=KKGDBVUFFAFBFG-UHFFFAOYSA-N
SMILES:C(C(O)=O)(F)(F)C1=C(Cl)C=CC=C1
Synonyms:
  • 2-Chloro-α,α-difluorobenzeneacetic acid
  • Benzeneacetic acid, 2-chloro-α,α-difluoro-
  • 2-(2-Chlorophenyl)-2,2-difluoroacetic acid
Found 3 products.