CymitQuimica logo

CAS 1150271-25-2

:

Ethyl 2,3-dihydro-2-oxo-5-oxazolecarboxylate

Description:
Ethyl 2,3-dihydro-2-oxo-5-oxazolecarboxylate is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This substance features a dihydro-2-oxo moiety, indicating the presence of a carbonyl group (C=O) adjacent to the oxazole ring, contributing to its reactivity and potential applications in organic synthesis. The ethyl ester functional group enhances its solubility in organic solvents, making it useful in various chemical reactions. The compound may exhibit biological activity, which is common among oxazole derivatives, and could be of interest in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. Additionally, the presence of the carboxylate group may facilitate further functionalization, allowing for the synthesis of more complex molecules. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C6H7NO4
InChI:InChI=1S/C6H7NO4/c1-2-10-5(8)4-3-7-6(9)11-4/h3H,2H2,1H3,(H,7,9)
InChI key:InChIKey=YUSJWUKJHXGPQN-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CNC(=O)O1
Synonyms:
  • Ethyl 2,3-dihydro-2-oxo-5-oxazolecarboxylate
  • Ethyl 2-oxo-2,3-dihydrooxazole-5-carboxylate
  • 5-Oxazolecarboxylic acid, 2,3-dihydro-2-oxo-, ethyl ester
Found 3 products.