CymitQuimica logo

CAS 1150271-34-3

:

3-Pyridinecarboxaldehyde, 4-bromo-, hydrobromide (1:1)

Description:
3-Pyridinecarboxaldehyde, 4-bromo-, hydrobromide (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a carboxaldehyde functional group (-CHO) at the 3-position and a bromine atom at the 4-position of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. The hydrobromide salt form indicates that the compound is associated with hydrobromic acid, enhancing its solubility in polar solvents and affecting its stability. This compound may exhibit properties typical of both aldehydes and halogenated aromatic compounds, such as electrophilicity and potential for nucleophilic substitution reactions. Its unique structure allows for various applications in medicinal chemistry, agrochemicals, and materials science. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C6H4BrNO·BrH
InChI:InChI=1S/C6H4BrNO.BrH/c7-6-1-2-8-3-5(6)4-9;/h1-4H;1H
InChI key:InChIKey=LRQCVMOGZSGCMW-UHFFFAOYSA-N
SMILES:C(=O)C=1C(Br)=CC=NC1.Br
Synonyms:
  • 3-Pyridinecarboxaldehyde, 4-bromo-, hydrobromide (1:1)
Found 4 products.