CymitQuimica logo

CAS 1150561-58-2

:

3-Pyridinecarboxylic acid, 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester

Description:
3-Pyridinecarboxylic acid, 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester, identified by CAS number 1150561-58-2, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the ethyl ester group indicates that it can undergo hydrolysis to release the corresponding carboxylic acid and ethanol. The incorporation of the dioxaborolane moiety suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions. The tetramethyl substitution on the dioxaborolane enhances its stability and solubility in organic solvents. Overall, this compound may exhibit interesting properties relevant to medicinal chemistry, agrochemicals, or materials science, depending on its specific reactivity and interactions with other chemical entities. Its unique structure makes it a candidate for further research in various chemical applications.
Formula:C15H22BNO4
InChI:InChI=1S/C15H22BNO4/c1-7-19-13(18)12-8-11(9-17-10(12)2)16-20-14(3,4)15(5,6)21-16/h8-9H,7H2,1-6H3
InChI key:InChIKey=JKRVLCLHODKBDC-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(C(OCC)=O)C(C)=NC2
Synonyms:
  • Ethyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-3-carboxylate
  • 3-Pyridinecarboxylic acid, 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester
  • Ethyl 2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate
Found 4 products.