CymitQuimica logo

CAS 1150561-82-2

:

Acetic acid, 2-(5-chloro-3-fluoro-2-pyridinyl)hydrazide

Description:
Acetic acid, 2-(5-chloro-3-fluoro-2-pyridinyl)hydrazide, is a chemical compound characterized by its hydrazide functional group, which is derived from acetic acid. This compound features a pyridine ring substituted with both chlorine and fluorine atoms, contributing to its unique chemical properties and potential biological activity. The presence of the hydrazide moiety suggests that it may participate in various chemical reactions, including condensation and hydrazone formation. The chlorine and fluorine substituents can influence the compound's reactivity, solubility, and interaction with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the compound's structure may impart specific pharmacological properties, potentially enhancing its efficacy in therapeutic applications. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential for its handling and use. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research and application.
Formula:C7H7ClFN3O
InChI:InChI=1S/C7H7ClFN3O/c1-4(13)11-12-7-6(9)2-5(8)3-10-7/h2-3H,1H3,(H,10,12)(H,11,13)
InChI key:InChIKey=NNYOKSGJLISDRJ-UHFFFAOYSA-N
SMILES:N(NC(C)=O)C1=C(F)C=C(Cl)C=N1
Synonyms:
  • Acetic acid, 2-(5-chloro-3-fluoro-2-pyridinyl)hydrazide
Found 2 products.