CymitQuimica logo

CAS 1150617-54-1

:

6-Bromo-1H-pyrazolo[4,3-b]pyridine

Description:
6-Bromo-1H-pyrazolo[4,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 6-position enhances its reactivity and potential for substitution reactions. This compound typically exhibits a pale yellow to off-white crystalline appearance and is soluble in organic solvents. Its molecular structure allows for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The compound may also exhibit interesting electronic properties owing to the conjugated system formed by the fused rings. Additionally, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-Bromo-1H-pyrazolo[4,3-b]pyridine is a significant compound in research and development within the field of organic chemistry.
Formula:C6H4BrN3
InChI:InChI=1S/C6H4BrN3/c7-4-1-5-6(8-2-4)3-9-10-5/h1-3H,(H,9,10)
InChI key:InChIKey=FONNZZMIJPHSJP-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(=NC1)C=NN2
Synonyms:
  • 1H-Pyrazolo[4,3-b]pyridine, 6-bromo-
  • 6-Bromo-1H-pyrazolo[4,3-b]pyridine
Found 4 products.