CymitQuimica logo

CAS 1150617-94-9

:

5-Iodo-2-methyl-2H-indazole

Description:
5-Iodo-2-methyl-2H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 5-position and a methyl group at the 2-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. It is of interest in various fields, including medicinal chemistry and material science, due to its potential biological activities and applications in drug development. The iodine substituent can enhance the compound's reactivity and influence its interaction with biological targets. Additionally, the indazole framework is known for its diverse pharmacological properties, making derivatives of this compound valuable in research. Safety and handling precautions should be observed, as with any halogenated compound, due to potential toxicity and environmental impact.
Formula:C8H7IN2
InChI:InChI=1S/C8H7IN2/c1-11-5-6-4-7(9)2-3-8(6)10-11/h2-5H,1H3
InChI key:InChIKey=FIQGETDPEXQPPK-UHFFFAOYSA-N
SMILES:CN1N=C2C(=C1)C=C(I)C=C2
Synonyms:
  • 2H-Indazole, 5-iodo-2-methyl-
  • 5-Iodo-2-methyl-2H-indazole
  • 5-iodo-2-methylindazole
Found 4 products.