CymitQuimica logo

CAS 1150618-20-4

:

4-Chloro-2-methyl-7-quinolinecarboxylic acid

Description:
4-Chloro-2-methyl-7-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system. This compound features a chloro substituent at the fourth position and a methyl group at the second position of the quinoline ring, along with a carboxylic acid functional group at the seventh position. The presence of the carboxylic acid group imparts acidic properties, making it capable of participating in various chemical reactions, such as esterification or amidation. The chloro and methyl groups contribute to the compound's overall reactivity and influence its solubility and stability in different solvents. This compound may be of interest in pharmaceutical research and development due to its potential biological activity, as quinoline derivatives are often explored for their medicinal properties. Additionally, its unique structure may allow for further modifications to enhance its efficacy or reduce toxicity in potential applications.
Formula:C11H8ClNO2
InChI:InChI=1S/C11H8ClNO2/c1-6-4-9(12)8-3-2-7(11(14)15)5-10(8)13-6/h2-5H,1H3,(H,14,15)
InChI key:InChIKey=OYEQPWTUUHEXCQ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(C(O)=O)C=C2)N=C(C)C1
Synonyms:
  • 7-Quinolinecarboxylic acid, 4-chloro-2-methyl-
  • 4-Chloro-2-methyl-7-quinolinecarboxylic acid
Found 4 products.