CymitQuimica logo

CAS 1150618-22-6

:

4-Hydroxy-7-quinolinecarboxylic acid

Description:
4-Hydroxy-7-quinolinecarboxylic acid, identified by its CAS number 1150618-22-6, is a chemical compound that features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. This compound is characterized by the presence of a hydroxyl group (-OH) at the 4-position and a carboxylic acid group (-COOH) at the 7-position of the quinoline structure. These functional groups contribute to its potential as a chelating agent, allowing it to form complexes with metal ions, which can be useful in various applications, including analytical chemistry and medicinal chemistry. The compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility, stability, and reactivity can vary depending on the pH and the presence of other chemical species. Overall, 4-Hydroxy-7-quinolinecarboxylic acid is a versatile compound with potential applications in both industrial and research settings.
Formula:C10H7NO3
InChI:InChI=1S/C10H7NO3/c12-9-3-4-11-8-5-6(10(13)14)1-2-7(8)9/h1-5H,(H,11,12)(H,13,14)
InChI key:InChIKey=QNDMXIULYGYMJK-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(C(O)=O)C=C2)N=CC1
Synonyms:
  • 4-Hydroxyquinoline-7-carboxylic acid
  • 7-Quinolinecarboxylic acid, 4-hydroxy-
  • 4-Hydroxy-7-quinolinecarboxylic acid
Found 3 products.