CAS 1151-98-0
:Apigeninidin
Description:
Apigeninidin is a flavonoid compound belonging to the anthocyanidin class, characterized by its vibrant pigmentation and potential health benefits. It is primarily found in various plants, particularly in certain fruits and flowers, contributing to their color and antioxidant properties. The chemical structure of apigeninidin features a chromone backbone with hydroxyl groups that enhance its reactivity and biological activity. This compound is known for its potential anti-inflammatory, antioxidant, and anticancer properties, making it of interest in nutritional and pharmaceutical research. Apigeninidin can also play a role in plant defense mechanisms against pathogens and environmental stressors. Its solubility in water and organic solvents varies, which can influence its bioavailability and efficacy in biological systems. Overall, apigeninidin represents a significant area of study within the field of natural products and phytochemistry, with ongoing research exploring its therapeutic applications and mechanisms of action.
Formula:C15H11O4·Cl
InChI:InChI=1S/C15H10O4.ClH/c16-10-3-1-9(2-4-10)14-6-5-12-13(18)7-11(17)8-15(12)19-14;/h1-8H,(H2-,16,17,18);1H
InChI key:InChIKey=GYQDOAKHUGURPD-UHFFFAOYSA-N
SMILES:OC=1C2=C([O+]=C(C=C2)C3=CC=C(O)C=C3)C=C(O)C1.[Cl-]
Synonyms:- 1-Benzopyrylium, 5,7-dihydroxy-2-(4-hydroxyphenyl)-, chloride
- 1-Benzopyrylium, 5,7-dihydroxy-2-(4-hydroxyphenyl)-, chloride (1:1)
- 2-(4-hydroxyphenyl)-2H-chromene-5,7-diol
- 4',5,7-Trihydroxyflavylium Chloride
- 4′,5,7-Trihydroxyflavylium chloride
- 5,7-Dihydroxy-2-(4-Hydroxyphenyl)Chromenium
- 5,7-Dihydroxy-2-(4-Hydroxyphenyl)Chromenium Chloride
- APIGENINIDIN hplc
- Apigenidin
- Apigenidin chloride
- Apigenidol chloride
- Apigeninidin
- Apigeninidin Chloride With Hplc
- Apigeninidin Chloride(P)
- Flavylium, 4′,5,7-trihydroxy-, chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Apigeninidin chloride
CAS:Apigeninidin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C15H11O4ClPurity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:290.69Apigeninidin (chloride)
CAS:Formula:C15H11ClO4Purity:98%Color and Shape:SolidMolecular weight:290.6984Apigeninidin chloride
CAS:Apigeninidin chloride is a natural product and antifungal agent capable of inducing apoptosis in leukaemia HL-60 cells by activation of Bak and Bax.Formula:C15H11ClO4Purity:97%Color and Shape:SolidMolecular weight:290.7Apigeninidin chloride
CAS:Apigeninidin chloride is an anthocyanidin compound, which is derived from plant sources such as sorghum and certain flowers. It possesses a distinct reddish-orange hue and is involved in various biological processes due to its polyphenolic structure. The mode of action of apigeninidin chloride includes its capacity to act as an antioxidant, effectively scavenging free radicals and reducing oxidative stress in cellular environments. This activity can mitigate damage to proteins, lipids, and nucleic acids, potentially playing a role in disease prevention and health maintenance.
Formula:C15H11ClO4Purity:Min. 95%Color and Shape:PowderMolecular weight:290.7 g/mol2-(4-Hydroxyphenyl)Chromenylium-5,7-Diol Chloride
CAS:Controlled ProductFormula:C15H11O4·ClColor and Shape:NeatMolecular weight:290.70






