CymitQuimica logo

CAS 1151564-03-2

:

1,3,2-Dioxaborolane,2-(2-chloro-3-methoxyphenyl)-4,4,5,5-tetramethyl-

Description:
1,3,2-Dioxaborolane, 2-(2-chloro-3-methoxyphenyl)-4,4,5,5-tetramethyl- is a chemical compound characterized by its unique dioxaborolane ring structure, which incorporates boron and oxygen atoms. This compound features a chloro-substituted methoxyphenyl group, contributing to its potential reactivity and applications in organic synthesis. The presence of tetramethyl groups enhances its steric bulk, which can influence its chemical behavior and solubility. Typically, dioxaborolanes are known for their utility in various chemical reactions, including cross-coupling reactions and as intermediates in the synthesis of more complex organic molecules. The specific substitution pattern of this compound may impart distinct electronic properties, making it of interest in medicinal chemistry and materials science. Additionally, the chlorine and methoxy groups can affect the compound's polarity and reactivity, potentially allowing for selective reactions in synthetic pathways. As with many boron-containing compounds, it may also exhibit unique interactions with nucleophiles and electrophiles, further broadening its applicability in chemical research and development.
Formula:C13H18BClO3
InChI:InChI=1S/C13H18BClO3/c1-12(2)13(3,4)18-14(17-12)9-7-6-8-10(16-5)11(9)15/h6-8H,1-5H3
InChI key:CVPMKYBFBINSHI-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)OC)Cl
Found 4 products.