CymitQuimica logo

CAS 1151665-15-4

:

tert-Butyl2-chloro-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate

Description:
Tert-Butyl 2-chloro-7,8-dihydro-1,6-naphthyridine-6(5H)-carboxylate is a chemical compound characterized by its complex structure, which includes a naphthyridine core, a tert-butyl ester group, and a chlorine substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of the naphthyridine moiety, which is known for its role in various pharmacological applications. The tert-butyl group contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. The chlorine atom may also affect the compound's reactivity and interaction with biological targets. In terms of stability, the presence of the carboxylate group suggests that it may participate in various chemical reactions, including esterification and nucleophilic substitution. Overall, this compound's unique structural features make it of interest in medicinal chemistry and drug development, although specific biological activities and applications would require further investigation.
Formula:C13H17ClN2O2
InChI:InChI=1S/C13H17ClN2O2/c1-13(2,3)18-12(17)16-7-6-10-9(8-16)4-5-11(14)15-10/h4-5H,6-8H2,1-3H3
InChI key:LPZHKCVGWZFNDC-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=N2)Cl
Found 4 products.