CymitQuimica logo

CAS 115175-17-2

:

3-amino-N-(4-chlorophenyl)benzamide

Description:
3-Amino-N-(4-chlorophenyl)benzamide, identified by its CAS number 115175-17-2, is an organic compound characterized by the presence of an amine group and a benzamide structure. This compound features a benzene ring substituted with an amino group at the meta position and a 4-chlorophenyl group attached to the nitrogen of the amide. The presence of the chlorine atom introduces a halogen, which can influence the compound's reactivity and solubility. Typically, compounds of this nature exhibit moderate to high polarity due to the amine and amide functional groups, which can engage in hydrogen bonding. This can affect their solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact can vary based on specific conditions and concentrations.
Formula:C13H11ClN2O
InChI:InChI=1/C13H11ClN2O/c14-10-4-6-12(7-5-10)16-13(17)9-2-1-3-11(15)8-9/h1-8H,15H2,(H,16,17)
InChI key:PFLYFNYASPUBRC-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)N)C(=O)Nc1ccc(cc1)Cl
Synonyms:
  • benzamide, 3-amino-N-(4-chlorophenyl)-
Found 2 products.