CymitQuimica logo

CAS 115310-98-0

:

2,4-Dimethyl-8-hydroxyquinoline

Description:
2,4-Dimethyl-8-hydroxyquinoline is an organic compound characterized by its quinoline structure, which features a bicyclic aromatic system. This compound contains two methyl groups at the 2 and 4 positions and a hydroxyl group at the 8 position of the quinoline ring, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the quinoline ring. The presence of the hydroxyl group imparts some polar characteristics, allowing for potential hydrogen bonding. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities, such as antimicrobial and antioxidant properties. Additionally, it may serve as a ligand in coordination chemistry or as a precursor in the synthesis of other complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H11NO
InChI:InChI=1/C11H11NO/c1-7-6-8(2)12-11-9(7)4-3-5-10(11)13/h3-6,13H,1-2H3
InChI key:UXFZNPGAWHMSRK-UHFFFAOYSA-N
SMILES:Cc1cc(C)nc2c1cccc2O
Synonyms:
  • 2,4-Dimethyl-8-quinolinol
  • 8-Quinolinol, 2,4-Dimethyl-
  • 8-Quinolinol, 2,4-Dimethyl- (9Ci)
  • 2,4-Dimethyl-Quinolin-8-Ol
Found 4 products.