CAS 115334-04-8

(5xi,13alpha,14beta,20S,23R,24S)-23,24-dihydroxy-25-methoxylanost-7-en-3-one

Formula: C₃₁H₅₂O₄

InChI: InChI=1/C31H52O4/c1-19(18-23(32)26(34)28(4,5)35-9)20-12-16-31(8)22-10-11-24-27(2,3)25(33)14-15-29(24,6)21(22)13-17-30(20,31)7/h10,19-21,23-24,26,32,34H,11-18H2,1-9H3/t19-,20+,21-,23+,24?,26-,29+,30-,31+/m0/s1

InChI key: OCURJKDUYAFAQG-PVZPVLANSA-N

SMILES: C[C@@H](C[C@H]([C@@H](C(C)(C)OC)O)O)[C@@H]1CC[C@]2([C@]1(CC[C@H]3C2=CC[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)C)C

Phellochin

CAS: 115334-04-8

Phellochin is a natural product of Phellodendron, Rutaceae.

Formula: C₃₁H₅₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 488.7422

Ref: TM-TN4762

Phellochin

CAS: 115334-04-8

Formula: C₃₁H₅₂O₄

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 488.753

Ref: BP-SBP01345

Phellochin

Controlled Product

CAS: 115334-04-8

Phellochin is a novel antifungal agent, which is a bioactive compound sourced from certain plant species known for their medicinal properties. The active constituents in this product are derived through a meticulous extraction process that isolates specific phytochemicals responsible for its antifungal activities. Its mode of action involves the disruption of fungal cell wall integrity, leading to cell lysis and death. This is achieved by inhibiting crucial enzymes involved in cell wall synthesis and through interference with membrane permeability.

Formula: C₃₁H₅₂O₄

Purity: Min. 95%

Molecular weight: 488.7 g/mol

Ref: 3D-QEA33404