CAS 1153949-11-1
:tert-Butyl 3-(cyanomethylene)azetidine-1-carboxylate
Description:
Tert-Butyl 3-(cyanomethylene)azetidine-1-carboxylate is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a tert-butyl ester group, contributing to its solubility and reactivity. The presence of a cyanomethylene group indicates that it has a nitrile functional group, which can enhance its reactivity in various chemical reactions, particularly in nucleophilic additions. The carboxylate moiety suggests that it can participate in esterification and other reactions typical of carboxylic acid derivatives. This compound may exhibit interesting properties such as potential biological activity, making it of interest in medicinal chemistry. Its structural features may also allow for various synthetic applications, including the formation of more complex molecules. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as temperature and pH. Safety data should be consulted for handling and storage, as compounds with nitrile groups can pose health risks.
Formula:C10H14N2O2
InChI:InChI=1S/C10H14N2O2/c1-10(2,3)14-9(13)12-6-8(7-12)4-5-11/h4H,6-7H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CC(=CC#N)C1
Synonyms:- 3-(Cyanomethylene)-1-azetidinecarboxylic acid tert-butyl ester
- 2-Methyl-2-propanyl 3-(cyanomethylene)-1-azetidinecarboxylate
- 1-Boc-3-(cyanomethylene)azetidine
- 3-Cyanomethylene-azetidine-1-carboxylic acid tert-butyl ester
- tert-butyl 3-(cyanoMethylidene)azetidine-1-carboxylate
- P-Hydroxy phenyl butanone (Raspberry ketone)
- tert-butyl-3-(cyanomethylene)azetidine-1-carboxylate
- 1-Azetidinecarboxylic acid, 3-(cyanomethylene)-, 1,1-dimethylethyl ester
- Baricitinib Impurity 10
- -Butoxycarbonyl)-3-(cyanomethylene)azetidine
- 1-(tert-Butoxycarbonyl)-3-(cyanomethylene)azetidine
- tert-Butyl 3-(cyanomethylene)
- 1-(
- tert
- benzyl 3-(cyanomethylene)azetidine-1-carboxylate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-(tert-Butoxycarbonyl)-3-(cyanomethylene)azetidine
CAS:Formula:C10H14N2O2Purity:>95.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:194.231-Azetidinecarboxylic acid, 3-(cyanomethylene)-, 1,1-dimethylethyl ester
CAS:Formula:C10H14N2O2Purity:98%Color and Shape:SolidMolecular weight:194.2304tert-Butyl 3-(cyanomethylene)azetidine-1-carboxylate
CAS:tert-Butyl 3-(cyanomethylene)azetidine-1-carboxylateFormula:C10H14N2O2Purity:97%Molecular weight:194.23036tert-Butyl 3-(cyanomethylene)azetidine-1-carboxylate
CAS:Formula:C10H14N2O2Purity:97%Color and Shape:SolidMolecular weight:194.234tert-Butyl 3-(cyanomethylene)azetidine-1-carboxylate
CAS:tert-Butyl 3-(cyanomethylene)azetidine-1-carboxylateFormula:C10H14N2O2Purity:98%Molecular weight:194.23





