CAS 1154-78-5
:Luteolinidin
Description:
Luteolinidin, with the CAS number 1154-78-5, is a flavonoid compound that belongs to the class of flavones. It is characterized by its yellow pigment, which is commonly found in various plants, particularly in the leaves and flowers. Luteolinidin exhibits antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and anticancer activities. The compound is soluble in organic solvents but has limited solubility in water, which affects its bioavailability. Its chemical structure features multiple hydroxyl groups, contributing to its reactivity and interaction with biological systems. Luteolinidin is often studied for its role in traditional medicine and its potential therapeutic applications, particularly in the context of chronic diseases. Additionally, it may play a role in plant defense mechanisms against pathogens and environmental stressors. Overall, luteolinidin is a significant compound in both phytochemistry and pharmacology, warranting further research into its biological activities and potential uses in health and nutrition.
Formula:C15H11O5·Cl
InChI:InChI=1S/C15H10O5.ClH/c16-9-6-12(18)10-2-4-14(20-15(10)7-9)8-1-3-11(17)13(19)5-8;/h1-7H,(H3-,16,17,18,19);1H
InChI key:InChIKey=MMAGHFOHXGFQRZ-UHFFFAOYSA-N
SMILES:OC=1C2=C([O+]=C(C=C2)C3=CC(O)=C(O)C=C3)C=C(O)C1.[Cl-]
Synonyms:- 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-, chloride
- 1-Benzopyrylium, 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-, chloride (1:1)
- 2-(3,4-Dihydroxyphenyl)-1-benzopyrylium-5,7-diol chloride
- 2-(3,4-Dihydroxyphenyl)-5,7-Dihydroxychromenium
- 2-(3,4-Dihydroxyphenyl)-5,7-Dihydroxychromenium Chloride
- 3',4',5,7-Tetrahydroxyflavylium Chloride
- 3′,4′,5,7-Tetrahydroxyflavylium chloride
- Flavylium, 3′,4′,5,7-tetrahydroxy-, chloride
- LUTEOLINIDIN CHLORIDE hplc
- Luteolinidin
- Luteolinidin Chloride With Hplc
- Luteolinidine Chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Luteolinidin chloride
CAS:Luteolinidin chloride analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C15H11O5ClPurity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:306.68Luteolinidin chloride
CAS:Luteolinidin chlorideFormula:C15H11ClO5Purity:≥98%, 10 mM in DMSOMolecular weight:306.7Luteolinidin chloride
CAS:Luteolinidin chloride: natural, inhibits CD38, shields the heart from I/R injury, sustains eNOS, prevents endothelial dysfunction.Formula:C15H11ClO5Purity:99.42% - 99.97%Color and Shape:Black SolidMolecular weight:306.7Luteolinidin chloride
CAS:Luteolinidin chloride is an anthocyanidin chloride, which is a type of plant-derived flavonoid. These compounds are naturally sourced from various plants where they contribute to pigmentation and protective functions. The mode of action of luteolinidin chloride primarily revolves around its antioxidative properties, which involve scavenging reactive oxygen species and mitigating oxidative stress within biological systems.Formula:C15H11ClO5Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:306.7 g/molLuteolinidin Chloride
CAS:Controlled ProductFormula:C15H11O5·ClColor and Shape:NeatMolecular weight:306.70Luteolinidin (chloride)
CAS:Formula:C15H11ClO5Purity:90%Color and Shape:SolidMolecular weight:306.6978








