CymitQuimica logo

CAS 115440-10-3

:

3-bromo-1,2-diamino-5-fluorobenzene

Description:
3-Bromo-1,2-diamino-5-fluorobenzene is an organic compound characterized by the presence of both amino and halogen functional groups on a benzene ring. The compound features a bromine atom and a fluorine atom, which are both halogens, attached to the aromatic ring, along with two amino groups (-NH2) located at the 1 and 2 positions. This substitution pattern contributes to its unique chemical reactivity and potential applications in pharmaceuticals and materials science. The presence of multiple functional groups can influence the compound's solubility, polarity, and overall reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the bromine and fluorine substituents can enhance the compound's biological activity, potentially making it useful in medicinal chemistry. As with many halogenated compounds, safety precautions should be taken due to the potential toxicity and environmental impact of halogenated substances.
Formula:C6H6BrFN2
InChI:InChI=1S/C6H6BrFN2/c7-4-1-3(8)2-5(9)6(4)10/h1-2H,9-10H2
InChI key:VCINLTLIJKUOQC-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1N)N)Br)F
Found 5 products.