CymitQuimica logo

CAS 115445-23-3

:

1-BENZYL-3-(TRIFLUOROACETAMIDO)PYRROLIDINE

Description:
1-Benzyl-3-(trifluoroacetamido)pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a benzyl group indicates that a phenyl ring is attached to a methylene (-CH2-) group, enhancing the compound's lipophilicity and potential biological activity. The trifluoroacetamido group introduces significant electronegativity due to the three fluorine atoms, which can influence the compound's reactivity and interaction with biological targets. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for pharmaceutical applications, particularly in the development of drugs targeting specific receptors or enzymes. Its unique structural features suggest that it could participate in various chemical reactions, including nucleophilic substitutions or acylation processes. As with many fluorinated compounds, it may also exhibit distinct physical properties, such as altered boiling and melting points compared to non-fluorinated analogs. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds.
Formula:C13H15F3N2O
InChI:InChI=1/C13H15F3N2O/c14-13(15,16)12(19)17-11-6-7-18(9-11)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,17,19)
InChI key:HFZWIEKMCFJKFB-UHFFFAOYSA-N
SMILES:c1ccc(cc1)CN1CCC(C1)N=C(C(F)(F)F)O
Synonyms:
  • 1-Benzyl-3-(Trifluoroacetamido)Pyrrolidine 96+%
  • N-(1-benzylpyrrolidin-3-yl)-2,2,2-trifluoroacetamide
Found 3 products.