CymitQuimica logo

CAS 1154639-88-9

:

3-[4-(2-Chloro-6-fluorobenzyl)-piperazin-1-yl]propanoic acid

Description:
3-[4-(2-Chloro-6-fluorobenzyl)-piperazin-1-yl]propanoic acid is a chemical compound characterized by its complex structure, which includes a propanoic acid moiety linked to a piperazine ring substituted with a chlorofluorobenzyl group. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the piperazine nitrogen atoms. It is likely to be soluble in polar solvents, given the presence of the carboxylic acid, while the aromatic and aliphatic components may contribute to its hydrophobic characteristics. The chlorine and fluorine substituents on the benzyl group can influence its biological activity and lipophilicity, potentially enhancing its interaction with biological targets. Such compounds are often investigated for their pharmacological properties, particularly in the context of central nervous system activity, due to the piperazine structure, which is common in various therapeutic agents. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry and drug development.
Formula:C14H18ClFN2O2
InChI:InChI=1S/C14H18ClFN2O2/c15-12-2-1-3-13(16)11(12)10-18-8-6-17(7-9-18)5-4-14(19)20/h1-3H,4-10H2,(H,19,20)
InChI key:SIFPFRBQSFUPEG-UHFFFAOYSA-N
SMILES:C1CN(CCN1CCC(=O)O)CC2=C(C=CC=C2Cl)F
Synonyms:
  • 3-[4-(2-Chloro-6-fluorobenzyl)-piperazin-1-yl]propanoic acid
  • 1-Piperazinepropanoic acid, 4-[(2-chloro-6-fluorophenyl)methyl]-
Found 1 products.