CymitQuimica logo

CAS 115467-08-8

:

4-Bromo-1-ethoxy-2-fluorobenzene

Description:
4-Bromo-1-ethoxy-2-fluorobenzene is an organic compound characterized by its aromatic structure, which includes a bromine atom and a fluorine atom substituted on a benzene ring, along with an ethoxy group. The presence of these substituents influences its chemical properties, such as reactivity and polarity. The bromine atom typically enhances the compound's electrophilic character, making it more reactive in nucleophilic substitution reactions. The fluorine atom, being highly electronegative, can affect the electron density on the aromatic ring, potentially influencing its reactivity and interaction with other chemical species. The ethoxy group contributes to the compound's solubility in organic solvents and can also participate in various chemical reactions. Overall, 4-Bromo-1-ethoxy-2-fluorobenzene is of interest in synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules or in the development of pharmaceuticals. Its specific properties, such as boiling point, melting point, and spectral characteristics, would require experimental determination or reference to chemical databases for precise values.
Formula:C8H8BrFO
InChI:InChI=1S/C8H8BrFO/c1-2-11-8-4-3-6(9)5-7(8)10/h3-5H,2H2,1H3
InChI key:InChIKey=ZMTIHOQUIPYSQK-UHFFFAOYSA-N
SMILES:O(CC)C1=C(F)C=C(Br)C=C1
Synonyms:
  • 1-Bromo-3-fluoro-4-ethoxybenzene
  • Benzene, 4-bromo-1-ethoxy-2-fluoro-
  • 4-Bromo-2-fluorophenetole
  • 4-Bromo-1-ethoxy-2-fluorobenzene
  • 4-Bromo-2-fluoroethoxybenzene
Found 3 products.